C19H23N5O4 — CID 113043584
ethyl 4-[6-[(2-methoxybenzoyl)amino]pyridazin-3-yl]piperazine-1-carboxylate (PubChem CID 113043584) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 4-[6-[(2-methoxybenzoyl)amino]pyridazin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[(2-methoxybenzoyl)amino]pyridazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 113043584 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | ethyl 4-[6-[(2-methoxybenzoyl)amino]pyridazin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc(NC(=O)c3ccccc3OC)nn2)CC1 |
| InChI | InChI=1S/C19H23N5O4/c1-3-28-19(26)24-12-10-23(11-13-24)17-9-8-16(21-22-17)20-18(25)14-6-4-5-7-15(14)27-2/h4-9H,3,10-13H2,1-2H3,(H,20,21,25) |
| InChIKey | PNBLJPISPHPFKY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |