C12H18N4O3 — CID 16883423
ethyl 4-(6-methoxypyridazin-3-yl)piperazine-1-carboxylate (PubChem CID 16883423) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is ethyl 4-(6-methoxypyridazin-3-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(6-methoxypyridazin-3-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 16883423 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | ethyl 4-(6-methoxypyridazin-3-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccc(OC)nn2)CC1 |
| InChI | InChI=1S/C12H18N4O3/c1-3-19-12(17)16-8-6-15(7-9-16)10-4-5-11(18-2)14-13-10/h4-5H,3,6-9H2,1-2H3 |
| InChIKey | LPZSWQDZJXVAML-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |