C20H24N4O4 — CID 109194154
ethyl 4-[5-(2-methoxyanilino)pyridine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 109194154) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl 4-[5-(2-methoxyanilino)pyridine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-(2-methoxyanilino)pyridine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109194154 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | ethyl 4-[5-(2-methoxyanilino)pyridine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(Nc3ccccc3OC)cn2)CC1 |
| InChI | InChI=1S/C20H24N4O4/c1-3-28-20(26)24-12-10-23(11-13-24)19(25)17-9-8-15(14-21-17)22-16-6-4-5-7-18(16)27-2/h4-9,14,22H,3,10-13H2,1-2H3 |
| InChIKey | AZMYLVDCBWQREA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |