C22H28Cl2N8O3 — CID 172929082
2-amino-1-prop-2-enoxyguanidine;2-chlorobenzaldehyde;2-[(E)-(2-chlorophenyl)methylideneamino]-1-prop-2-enoxyguanidine (PubChem CID 172929082) has the molecular formula C22H28Cl2N8O3 and a molecular weight of 523.43 g/mol. Its IUPAC name is 2-amino-1-prop-2-enoxyguanidine;2-chlorobenzaldehyde;2-[(E)-(2-chlorophenyl)methylideneamino]-1-prop-2-enoxyguanidine.
| Compound Name | 2-amino-1-prop-2-enoxyguanidine;2-chlorobenzaldehyde;2-[(E)-(2-chlorophenyl)methylideneamino]-1-prop-2-enoxyguanidine |
|---|---|
| PubChem CID | 172929082 |
| Molecular Formula | C22H28Cl2N8O3 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 2-amino-1-prop-2-enoxyguanidine;2-chlorobenzaldehyde;2-[(E)-(2-chlorophenyl)methylideneamino]-1-prop-2-enoxyguanidine |
| SMILES | C=CCONC(N)=N/N=C/c1ccccc1Cl.C=CCONC(N)=NN.O=Cc1ccccc1Cl |
| InChI | InChI=1S/C11H13ClN4O.C7H5ClO.C4H10N4O/c1-2-7-17-16-11(13)15-14-8-9-5-3-4-6-10(9)12;8-7-4-2-1-3-6(7)5-9;1-2-3-9-8-4(5)7-6/h2-6,8H,1,7H2,(H3,13,15,16);1-5H;2H,1,3,6H2,(H3,5,7,8)/b14-8+;; |
| InChIKey | SCEPXELTRZFODI-JPMXUBAOSA-N |
| XLogP | 2.73 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|