C24H36Cl2N8O3 — CID 172950603
2-amino-1-butoxyguanidine;1-butoxy-2-[(E)-(2-chlorophenyl)methylideneamino]guanidine;2-chlorobenzaldehyde (PubChem CID 172950603) has the molecular formula C24H36Cl2N8O3 and a molecular weight of 555.51 g/mol. Its IUPAC name is 2-amino-1-butoxyguanidine;1-butoxy-2-[(E)-(2-chlorophenyl)methylideneamino]guanidine;2-chlorobenzaldehyde.
| Compound Name | 2-amino-1-butoxyguanidine;1-butoxy-2-[(E)-(2-chlorophenyl)methylideneamino]guanidine;2-chlorobenzaldehyde |
|---|---|
| PubChem CID | 172950603 |
| Molecular Formula | C24H36Cl2N8O3 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-amino-1-butoxyguanidine;1-butoxy-2-[(E)-(2-chlorophenyl)methylideneamino]guanidine;2-chlorobenzaldehyde |
| SMILES | CCCCONC(N)=N/N=C/c1ccccc1Cl.CCCCONC(N)=NN.O=Cc1ccccc1Cl |
| InChI | InChI=1S/C12H17ClN4O.C7H5ClO.C5H14N4O/c1-2-3-8-18-17-12(14)16-15-9-10-6-4-5-7-11(10)13;8-7-4-2-1-3-6(7)5-9;1-2-3-4-10-9-5(6)8-7/h4-7,9H,2-3,8H2,1H3,(H3,14,16,17);1-5H;2-4,7H2,1H3,(H3,6,8,9)/b15-9+;; |
| InChIKey | GYKDHLHSPIULQY-CBNWXSEKSA-N |
| XLogP | 3.96 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|