C28H40Cl2N6O2 — CID 172929516
2-[(E)-(2-chlorophenyl)methylideneamino]-1-(3-methylbutoxy)guanidine;1-N-[(2-chlorophenyl)methylidene]-3-(3-methylbutoxy)propane-1,2-diimine (PubChem CID 172929516) has the molecular formula C28H40Cl2N6O2 and a molecular weight of 563.57 g/mol. Its IUPAC name is 2-[(E)-(2-chlorophenyl)methylideneamino]-1-(3-methylbutoxy)guanidine;1-N-[(2-chlorophenyl)methylidene]-3-(3-methylbutoxy)propane-1,2-diimine.
| Compound Name | 2-[(E)-(2-chlorophenyl)methylideneamino]-1-(3-methylbutoxy)guanidine;1-N-[(2-chlorophenyl)methylidene]-3-(3-methylbutoxy)propane-1,2-diimine |
|---|---|
| PubChem CID | 172929516 |
| Molecular Formula | C28H40Cl2N6O2 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 2-[(E)-(2-chlorophenyl)methylideneamino]-1-(3-methylbutoxy)guanidine;1-N-[(2-chlorophenyl)methylidene]-3-(3-methylbutoxy)propane-1,2-diimine |
| SMILES | CC(C)CCON/C(N)=N/N=C/c1ccccc1Cl.[H]/N=C(/C/N=C/c1ccccc1Cl)COCCC(C)C |
| InChI | InChI=1S/C15H21ClN2O.C13H19ClN4O/c1-12(2)7-8-19-11-14(17)10-18-9-13-5-3-4-6-15(13)16;1-10(2)7-8-19-18-13(15)17-16-9-11-5-3-4-6-12(11)14/h3-6,9,12,17H,7-8,10-11H2,1-2H3;3-6,9-10H,7-8H2,1-2H3,(H3,15,17,18)/b17-14-,18-9+;16-9+ |
| InChIKey | NYVHQBKGTKBPNA-WDBKCMIWSA-N |
| XLogP | 6.40 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|