C17H15Cl2N3 — CID 159435601
1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine (PubChem CID 159435601) has the molecular formula C17H15Cl2N3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine.
| Compound Name | 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine |
|---|---|
| PubChem CID | 159435601 |
| Molecular Formula | C17H15Cl2N3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine |
| SMILES | [H]/N=C(\C/N=C/c1ccc(Cl)cc1)C/N=C/c1ccccc1Cl |
| InChI | InChI=1S/C17H15Cl2N3/c18-15-7-5-13(6-8-15)9-21-11-16(20)12-22-10-14-3-1-2-4-17(14)19/h1-10,20H,11-12H2/b20-16+,21-9+,22-10+ |
| InChIKey | LRNRDOQTZLMJBA-MFMBENMASA-N |
| XLogP | 4.55 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|