About 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine
1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine (PubChem CID 159435601) has the molecular formula C17H15Cl2N3
and a molecular weight of 332.23 g/mol. Its IUPAC name is 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine.
Molecular Properties
| Compound Name | 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine |
| PubChem CID | 159435601 |
| Molecular Formula | C17H15Cl2N3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine |
| SMILES | [H]/N=C(\C/N=C/c1ccc(Cl)cc1)C/N=C/c1ccccc1Cl |
| InChI | InChI=1S/C17H15Cl2N3/c18-15-7-5-13(6-8-15)9-21-11-16(20)12-22-10-14-3-1-2-4-17(14)19/h1-10,20H,11-12H2/b20-16+,21-9+,22-10+ |
| InChIKey | LRNRDOQTZLMJBA-MFMBENMASA-N |
| XLogP | 4.55 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine?
The IUPAC name of 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine (CID 159435601) is 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine.
What is the SMILES notation for 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine?
The canonical SMILES for 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine is [H]/N=C(\C/N=C/c1ccc(Cl)cc1)C/N=C/c1ccccc1Cl.
What is the InChIKey of 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine?
The InChIKey is LRNRDOQTZLMJBA-MFMBENMASA-N. The full InChI is InChI=1S/C17H15Cl2N3/c18-15-7-5-13(6-8-15)9-21-11-16(20)12-22-10-14-3-1-2-4-17(14)19/h1-10,20H,11-12H2/b20-16+,21-9+,22-10+.
What are the key properties of 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine?
1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine has a molecular weight of 332.23 g/mol, XLogP of 4.55, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(2-chlorophenyl)methylidene]-3-N-[(4-chlorophenyl)methylidene]propane-1,2,3-triimine is sourced from PubChem (CID 159435601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).