C9H16N8O2 — CID 135446475
N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide (PubChem CID 135446475) has the molecular formula C9H16N8O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide.
| Compound Name | N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 135446475 |
| Molecular Formula | C9H16N8O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide |
| SMILES | CC(=O)NC(N)=NN=CC(C)=NN=C(N)NC(C)=O |
| InChI | InChI=1S/C9H16N8O2/c1-5(15-17-9(11)14-7(3)19)4-12-16-8(10)13-6(2)18/h4H,1-3H3,(H3,10,13,16,18)(H3,11,14,17,19) |
| InChIKey | ONCIKFBLCLVLJJ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 159.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|