About N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide
N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide (PubChem CID 135446475) has the molecular formula C9H16N8O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide.
Molecular Properties
| Compound Name | N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide |
| PubChem CID | 135446475 |
| Molecular Formula | C9H16N8O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide |
| SMILES | CC(=O)NC(N)=NN=CC(C)=NN=C(N)NC(C)=O |
| InChI | InChI=1S/C9H16N8O2/c1-5(15-17-9(11)14-7(3)19)4-12-16-8(10)13-6(2)18/h4H,1-3H3,(H3,10,13,16,18)(H3,11,14,17,19) |
| InChIKey | ONCIKFBLCLVLJJ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 159.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide?
The IUPAC name of N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide (CID 135446475) is N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide.
What is the SMILES notation for N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide?
The canonical SMILES for N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide is CC(=O)NC(N)=NN=CC(C)=NN=C(N)NC(C)=O.
What is the InChIKey of N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide?
The InChIKey is ONCIKFBLCLVLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N8O2/c1-5(15-17-9(11)14-7(3)19)4-12-16-8(10)13-6(2)18/h4H,1-3H3,(H3,10,13,16,18)(H3,11,14,17,19).
What are the key properties of N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide?
N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide has a molecular weight of 268.28 g/mol, XLogP of -1.75, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[N'-[2-[[acetamido(amino)methylidene]hydrazinylidene]propylideneamino]carbamimidoyl]acetamide is sourced from PubChem (CID 135446475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).