About N-(N'-propoxycarbamimidoyl)acetamide
N-(N'-propoxycarbamimidoyl)acetamide (PubChem CID 154044965) has the molecular formula C6H13N3O2
and a molecular weight of 159.19 g/mol. Its IUPAC name is N-(N'-propoxycarbamimidoyl)acetamide.
Molecular Properties
| Compound Name | N-(N'-propoxycarbamimidoyl)acetamide |
| PubChem CID | 154044965 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-(N'-propoxycarbamimidoyl)acetamide |
| SMILES | CCCON=C(N)NC(C)=O |
| InChI | InChI=1S/C6H13N3O2/c1-3-4-11-9-6(7)8-5(2)10/h3-4H2,1-2H3,(H3,7,8,9,10) |
| InChIKey | ZMDISZMYWDANAC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(N'-propoxycarbamimidoyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N'-propoxycarbamimidoyl)acetamide?
The IUPAC name of N-(N'-propoxycarbamimidoyl)acetamide (CID 154044965) is N-(N'-propoxycarbamimidoyl)acetamide.
What is the SMILES notation for N-(N'-propoxycarbamimidoyl)acetamide?
The canonical SMILES for N-(N'-propoxycarbamimidoyl)acetamide is CCCON=C(N)NC(C)=O.
What is the InChIKey of N-(N'-propoxycarbamimidoyl)acetamide?
The InChIKey is ZMDISZMYWDANAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2/c1-3-4-11-9-6(7)8-5(2)10/h3-4H2,1-2H3,(H3,7,8,9,10).
What are the key properties of N-(N'-propoxycarbamimidoyl)acetamide?
N-(N'-propoxycarbamimidoyl)acetamide has a molecular weight of 159.19 g/mol, XLogP of -0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N'-propoxycarbamimidoyl)acetamide is sourced from PubChem (CID 154044965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).