About N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide
N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide (PubChem CID 135834187) has the molecular formula C22H17Cl2N5O
and a molecular weight of 438.32 g/mol. Its IUPAC name is N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide.
Molecular Properties
| Compound Name | N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide |
| PubChem CID | 135834187 |
| Molecular Formula | C22H17Cl2N5O |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N/N=C/c1ccccc1Cl)N/N=C/c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H17Cl2N5O/c23-19-12-6-4-10-17(19)14-25-28-22(27-21(30)16-8-2-1-3-9-16)29-26-15-18-11-5-7-13-20(18)24/h1-15H,(H2,27,28,29,30)/b25-14+,26-15+ |
| InChIKey | BVLQXZCKQXKVGS-LVSXPEEVSA-N |
| XLogP | 4.74 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide?
The IUPAC name of N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide (CID 135834187) is N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide.
What is the SMILES notation for N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide?
The canonical SMILES for N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide is O=C(N/C(=N/N=C/c1ccccc1Cl)N/N=C/c1ccccc1Cl)c1ccccc1.
What is the InChIKey of N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide?
The InChIKey is BVLQXZCKQXKVGS-LVSXPEEVSA-N. The full InChI is InChI=1S/C22H17Cl2N5O/c23-19-12-6-4-10-17(19)14-25-28-22(27-21(30)16-8-2-1-3-9-16)29-26-15-18-11-5-7-13-20(18)24/h1-15H,(H2,27,28,29,30)/b25-14+,26-15+.
What are the key properties of N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide?
N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide has a molecular weight of 438.32 g/mol, XLogP of 4.74, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-N,N'-bis[(E)-(2-chlorophenyl)methylideneamino]carbamimidoyl]benzamide is sourced from PubChem (CID 135834187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).