C9H11ClN4S — CID 68790902
2-[(3-chloro-2-methylsulfanylphenyl)methylideneamino]guanidine (PubChem CID 68790902) has the molecular formula C9H11ClN4S and a molecular weight of 242.74 g/mol. Its IUPAC name is 2-[(3-chloro-2-methylsulfanylphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(3-chloro-2-methylsulfanylphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 68790902 |
| Molecular Formula | C9H11ClN4S |
| Molecular Weight | 242.74 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-[(3-chloro-2-methylsulfanylphenyl)methylideneamino]guanidine |
| SMILES | CSc1c(Cl)cccc1C=NN=C(N)N |
| InChI | InChI=1S/C9H11ClN4S/c1-15-8-6(3-2-4-7(8)10)5-13-14-9(11)12/h2-5H,1H3,(H4,11,12,14) |
| InChIKey | JQPVTKVUFMXMGY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.74 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|