C18H21Cl2F3N8 — CID 145167086
2-[(E)-(2-chloro-3,5-difluorophenyl)methylideneamino]guanidine;2-[(E)-(3-chloro-2-fluorophenyl)methylideneamino]guanidine;ethane (PubChem CID 145167086) has the molecular formula C18H21Cl2F3N8 and a molecular weight of 477.32 g/mol. Its IUPAC name is 2-[(E)-(2-chloro-3,5-difluorophenyl)methylideneamino]guanidine;2-[(E)-(3-chloro-2-fluorophenyl)methylideneamino]guanidine;ethane.
| Compound Name | 2-[(E)-(2-chloro-3,5-difluorophenyl)methylideneamino]guanidine;2-[(E)-(3-chloro-2-fluorophenyl)methylideneamino]guanidine;ethane |
|---|---|
| PubChem CID | 145167086 |
| Molecular Formula | C18H21Cl2F3N8 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-[(E)-(2-chloro-3,5-difluorophenyl)methylideneamino]guanidine;2-[(E)-(3-chloro-2-fluorophenyl)methylideneamino]guanidine;ethane |
| SMILES | CC.NC(N)=N/N=C/c1cc(F)cc(F)c1Cl.NC(N)=N/N=C/c1cccc(Cl)c1F |
| InChI | InChI=1S/C8H7ClF2N4.C8H8ClFN4.C2H6/c9-7-4(3-14-15-8(12)13)1-5(10)2-6(7)11;9-6-3-1-2-5(7(6)10)4-13-14-8(11)12;1-2/h1-3H,(H4,12,13,15);1-4H,(H4,11,12,14);1-2H3/b14-3+;13-4+; |
| InChIKey | NWSLSMTZBIGDGN-KAQYBRNSSA-N |
| XLogP | 3.34 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|