C10H12FN5O4 — CID 146217275
acetic acid;2-[(2-fluoro-6-nitrophenyl)methylideneamino]guanidine (PubChem CID 146217275) has the molecular formula C10H12FN5O4 and a molecular weight of 285.24 g/mol. Its IUPAC name is acetic acid;2-[(2-fluoro-6-nitrophenyl)methylideneamino]guanidine.
| Compound Name | acetic acid;2-[(2-fluoro-6-nitrophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 146217275 |
| Molecular Formula | C10H12FN5O4 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | acetic acid;2-[(2-fluoro-6-nitrophenyl)methylideneamino]guanidine |
| SMILES | CC(=O)O.NC(N)=NN=Cc1c(F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8FN5O2.C2H4O2/c9-6-2-1-3-7(14(15)16)5(6)4-12-13-8(10)11;1-2(3)4/h1-4H,(H4,10,11,13);1H3,(H,3,4) |
| InChIKey | JTSZLKSUNTULEX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|