C10H12N6O6 — CID 89145272
acetic acid;2-[(E)-(3,5-dinitrophenyl)methylideneamino]guanidine (PubChem CID 89145272) has the molecular formula C10H12N6O6 and a molecular weight of 312.24 g/mol. Its IUPAC name is acetic acid;2-[(E)-(3,5-dinitrophenyl)methylideneamino]guanidine.
| Compound Name | acetic acid;2-[(E)-(3,5-dinitrophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 89145272 |
| Molecular Formula | C10H12N6O6 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | acetic acid;2-[(E)-(3,5-dinitrophenyl)methylideneamino]guanidine |
| SMILES | CC(=O)O.NC(N)=N/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H8N6O4.C2H4O2/c9-8(10)12-11-4-5-1-6(13(15)16)3-7(2-5)14(17)18;1-2(3)4/h1-4H,(H4,9,10,12);1H3,(H,3,4)/b11-4+; |
| InChIKey | WTCDAYQCMHHYKW-SODSUQDMSA-N |
| XLogP | 0.20 |
| TPSA | 200.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|