C10H11BrClN5O4 — CID 87175720
acetic acid;2-[(E)-(2-bromo-5-chloro-3-nitrophenyl)methylideneamino]guanidine (PubChem CID 87175720) has the molecular formula C10H11BrClN5O4 and a molecular weight of 380.59 g/mol. Its IUPAC name is acetic acid;2-[(E)-(2-bromo-5-chloro-3-nitrophenyl)methylideneamino]guanidine.
| Compound Name | acetic acid;2-[(E)-(2-bromo-5-chloro-3-nitrophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 87175720 |
| Molecular Formula | C10H11BrClN5O4 |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | acetic acid;2-[(E)-(2-bromo-5-chloro-3-nitrophenyl)methylideneamino]guanidine |
| SMILES | CC(=O)O.NC(N)=N/N=C/c1cc(Cl)cc([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C8H7BrClN5O2.C2H4O2/c9-7-4(3-13-14-8(11)12)1-5(10)2-6(7)15(16)17;1-2(3)4/h1-3H,(H4,11,12,14);1H3,(H,3,4)/b13-3+; |
| InChIKey | NJXXBXLPCAMERQ-QPZBGDMRSA-N |
| XLogP | 1.71 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|