C10H10BrClN4O3 — CID 168592587
2-[2-bromo-4-chloro-6-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetic acid (PubChem CID 168592587) has the molecular formula C10H10BrClN4O3 and a molecular weight of 349.57 g/mol. Its IUPAC name is 2-[2-bromo-4-chloro-6-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-chloro-6-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 168592587 |
| Molecular Formula | C10H10BrClN4O3 |
| Molecular Weight | 349.57 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 2-[2-bromo-4-chloro-6-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]acetic acid |
| SMILES | NC(N)=NN=Cc1cc(Cl)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C10H10BrClN4O3/c11-7-2-6(12)1-5(3-15-16-10(13)14)9(7)19-4-8(17)18/h1-3H,4H2,(H,17,18)(H4,13,14,16) |
| InChIKey | SPYYOELHIVECAI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.57 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|