C8H6BrF3N4 — CID 168592496
2-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]guanidine (PubChem CID 168592496) has the molecular formula C8H6BrF3N4 and a molecular weight of 295.06 g/mol. Its IUPAC name is 2-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]guanidine.
| Compound Name | 2-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592496 |
| Molecular Formula | C8H6BrF3N4 |
| Molecular Weight | 295.06 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 2-[(4-bromo-2,3,6-trifluorophenyl)methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1c(F)cc(Br)c(F)c1F |
| InChI | InChI=1S/C8H6BrF3N4/c9-4-1-5(10)3(6(11)7(4)12)2-15-16-8(13)14/h1-2H,(H4,13,14,16) |
| InChIKey | ULNSMCOLCQQQMC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.06 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|