C9H10BrFN4 — CID 168591308
2-[[4-(bromomethyl)-2-fluorophenyl]methylideneamino]guanidine (PubChem CID 168591308) has the molecular formula C9H10BrFN4 and a molecular weight of 273.11 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)-2-fluorophenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-(bromomethyl)-2-fluorophenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591308 |
| Molecular Formula | C9H10BrFN4 |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 2-[[4-(bromomethyl)-2-fluorophenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccc(CBr)cc1F |
| InChI | InChI=1S/C9H10BrFN4/c10-4-6-1-2-7(8(11)3-6)5-14-15-9(12)13/h1-3,5H,4H2,(H4,12,13,15) |
| InChIKey | MARGGXTWQPZSHN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|