C12H16BrFN4 — CID 168592843
2-[(3-bromo-5-tert-butyl-2-fluorophenyl)methylideneamino]guanidine (PubChem CID 168592843) has the molecular formula C12H16BrFN4 and a molecular weight of 315.19 g/mol. Its IUPAC name is 2-[(3-bromo-5-tert-butyl-2-fluorophenyl)methylideneamino]guanidine.
| Compound Name | 2-[(3-bromo-5-tert-butyl-2-fluorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592843 |
| Molecular Formula | C12H16BrFN4 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-[(3-bromo-5-tert-butyl-2-fluorophenyl)methylideneamino]guanidine |
| SMILES | CC(C)(C)c1cc(Br)c(F)c(C=NN=C(N)N)c1 |
| InChI | InChI=1S/C12H16BrFN4/c1-12(2,3)8-4-7(6-17-18-11(15)16)10(14)9(13)5-8/h4-6H,1-3H3,(H4,15,16,18) |
| InChIKey | ZKUIDYYBYNWBOF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|