C17H19N9S — CID 137394769
2-[(E)-[8-[(E)-(diaminomethylidenehydrazinylidene)methyl]-10-methylphenothiazin-2-yl]methylideneamino]guanidine (PubChem CID 137394769) has the molecular formula C17H19N9S and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-[(E)-[8-[(E)-(diaminomethylidenehydrazinylidene)methyl]-10-methylphenothiazin-2-yl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[8-[(E)-(diaminomethylidenehydrazinylidene)methyl]-10-methylphenothiazin-2-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 137394769 |
| Molecular Formula | C17H19N9S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[(E)-[8-[(E)-(diaminomethylidenehydrazinylidene)methyl]-10-methylphenothiazin-2-yl]methylideneamino]guanidine |
| SMILES | CN1c2cc(/C=N/N=C(N)N)ccc2Sc2ccc(/C=N/N=C(N)N)cc21 |
| InChI | InChI=1S/C17H19N9S/c1-26-12-6-10(8-22-24-16(18)19)2-4-14(12)27-15-5-3-11(7-13(15)26)9-23-25-17(20)21/h2-9H,1H3,(H4,18,19,24)(H4,20,21,25)/b22-8+,23-9+ |
| InChIKey | KSDZDSMUCJMULF-NZRSMXNRSA-N |
| XLogP | 1.13 |
| TPSA | 156.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|