C20H25N3O4S2 — CID 4020384
[2-methoxy-4-[(propan-2-ylcarbamothioylhydrazinylidene)methyl]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 4020384) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is [2-methoxy-4-[(propan-2-ylcarbamothioylhydrazinylidene)methyl]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [2-methoxy-4-[(propan-2-ylcarbamothioylhydrazinylidene)methyl]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 4020384 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | [2-methoxy-4-[(propan-2-ylcarbamothioylhydrazinylidene)methyl]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | COc1cc(C=NNC(=S)NC(C)C)ccc1OS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C20H25N3O4S2/c1-13(2)22-20(28)23-21-12-16-8-9-17(18(11-16)26-5)27-29(24,25)19-10-14(3)6-7-15(19)4/h6-13H,1-5H3,(H2,22,23,28) |
| InChIKey | HZLLYILAEZPPRI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|