C13H11Cl2N3O — CID 23376464
6-amino-1-[(2,6-dichlorophenyl)methylideneamino]-4-methylpyridin-2-one (PubChem CID 23376464) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is 6-amino-1-[(2,6-dichlorophenyl)methylideneamino]-4-methylpyridin-2-one.
| Compound Name | 6-amino-1-[(2,6-dichlorophenyl)methylideneamino]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 23376464 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 6-amino-1-[(2,6-dichlorophenyl)methylideneamino]-4-methylpyridin-2-one |
| SMILES | Cc1cc(N)n(N=Cc2c(Cl)cccc2Cl)c(=O)c1 |
| InChI | InChI=1S/C13H11Cl2N3O/c1-8-5-12(16)18(13(19)6-8)17-7-9-10(14)3-2-4-11(9)15/h2-7H,16H2,1H3 |
| InChIKey | FYUPAHJSNMAJNW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|