C22H16N6O — CID 2005345
17-(benzylideneamino)-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 2005345) has the molecular formula C22H16N6O and a molecular weight of 380.41 g/mol. Its IUPAC name is 17-(benzylideneamino)-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 17-(benzylideneamino)-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 2005345 |
| Molecular Formula | C22H16N6O |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 17-(benzylideneamino)-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | C=CCn1cnc2c(c1=O)c1nc3ccccc3nc1n2N=Cc1ccccc1 |
| InChI | InChI=1S/C22H16N6O/c1-2-12-27-14-23-20-18(22(27)29)19-21(26-17-11-7-6-10-16(17)25-19)28(20)24-13-15-8-4-3-5-9-15/h2-11,13-14H,1,12H2 |
| InChIKey | BMSRJNZTLBDBQR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|