C26H24N7O+ — CID 135649082
13-[2-(cyclohexen-1-yl)ethyl]-17-[(E)-pyridin-1-ium-4-ylmethylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 135649082) has the molecular formula C26H24N7O+ and a molecular weight of 450.53 g/mol. Its IUPAC name is 13-[2-(cyclohexen-1-yl)ethyl]-17-[(E)-pyridin-1-ium-4-ylmethylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 13-[2-(cyclohexen-1-yl)ethyl]-17-[(E)-pyridin-1-ium-4-ylmethylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 135649082 |
| Molecular Formula | C26H24N7O+ |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 13-[2-(cyclohexen-1-yl)ethyl]-17-[(E)-pyridin-1-ium-4-ylmethylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | O=c1c2c3nc4ccccc4nc3n(/N=C/c3cc[nH+]cc3)c2ncn1CCC1=CCCCC1 |
| InChI | InChI=1S/C26H23N7O/c34-26-22-23-25(31-21-9-5-4-8-20(21)30-23)33(29-16-19-10-13-27-14-11-19)24(22)28-17-32(26)15-12-18-6-2-1-3-7-18/h4-6,8-11,13-14,16-17H,1-3,7,12,15H2/p+1/b29-16+ |
| InChIKey | MEVPJYJKAQYTKZ-MUFRIFMGSA-O |
| XLogP | 3.88 |
| TPSA | 92.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|