C21H17N7O2 — CID 2005493
13-(2-methoxyethyl)-17-(pyridin-2-ylmethylideneamino)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 2005493) has the molecular formula C21H17N7O2 and a molecular weight of 399.41 g/mol. Its IUPAC name is 13-(2-methoxyethyl)-17-(pyridin-2-ylmethylideneamino)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 13-(2-methoxyethyl)-17-(pyridin-2-ylmethylideneamino)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 2005493 |
| Molecular Formula | C21H17N7O2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 13-(2-methoxyethyl)-17-(pyridin-2-ylmethylideneamino)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | COCCn1cnc2c(c1=O)c1nc3ccccc3nc1n2N=Cc1ccccn1 |
| InChI | InChI=1S/C21H17N7O2/c1-30-11-10-27-13-23-19-17(21(27)29)18-20(26-16-8-3-2-7-15(16)25-18)28(19)24-12-14-6-4-5-9-22-14/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | XBKPVTBQBHBTJZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|