C31H28N6O — CID 6890514
17-[(E)-(4-tert-butylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 6890514) has the molecular formula C31H28N6O and a molecular weight of 500.61 g/mol. Its IUPAC name is 17-[(E)-(4-tert-butylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 17-[(E)-(4-tert-butylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 6890514 |
| Molecular Formula | C31H28N6O |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 17-[(E)-(4-tert-butylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | CC(C)(C)c1ccc(/C=N/n2c3nc4ccccc4nc3c3c(=O)n(CCc4ccccc4)cnc32)cc1 |
| InChI | InChI=1S/C31H28N6O/c1-31(2,3)23-15-13-22(14-16-23)19-33-37-28-26(27-29(37)35-25-12-8-7-11-24(25)34-27)30(38)36(20-32-28)18-17-21-9-5-4-6-10-21/h4-16,19-20H,17-18H2,1-3H3/b33-19+ |
| InChIKey | FXFDCVVHFVHHQV-HNSNBQBZSA-N |
| XLogP | 5.72 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|