C29H24N6O — CID 6887077
14-methyl-17-[(E)-(3-methylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 6887077) has the molecular formula C29H24N6O and a molecular weight of 472.55 g/mol. Its IUPAC name is 14-methyl-17-[(E)-(3-methylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 14-methyl-17-[(E)-(3-methylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 6887077 |
| Molecular Formula | C29H24N6O |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 14-methyl-17-[(E)-(3-methylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | Cc1cccc(/C=N/n2c3nc4ccccc4nc3c3c(=O)n(CCc4ccccc4)c(C)nc32)c1 |
| InChI | InChI=1S/C29H24N6O/c1-19-9-8-12-22(17-19)18-30-35-27-25(26-28(35)33-24-14-7-6-13-23(24)32-26)29(36)34(20(2)31-27)16-15-21-10-4-3-5-11-21/h3-14,17-18H,15-16H2,1-2H3/b30-18+ |
| InChIKey | MOMNLQGXQVRBFP-UXHLAJHPSA-N |
| XLogP | 5.04 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|