C26H17ClN6O — CID 2008145
17-[(3-chlorophenyl)methylideneamino]-14-methyl-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 2008145) has the molecular formula C26H17ClN6O and a molecular weight of 464.92 g/mol. Its IUPAC name is 17-[(3-chlorophenyl)methylideneamino]-14-methyl-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 17-[(3-chlorophenyl)methylideneamino]-14-methyl-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 2008145 |
| Molecular Formula | C26H17ClN6O |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 17-[(3-chlorophenyl)methylideneamino]-14-methyl-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | Cc1nc2c(c(=O)n1-c1ccccc1)c1nc3ccccc3nc1n2N=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H17ClN6O/c1-16-29-24-22(26(34)32(16)19-10-3-2-4-11-19)23-25(31-21-13-6-5-12-20(21)30-23)33(24)28-15-17-8-7-9-18(27)14-17/h2-15H,1H3 |
| InChIKey | YCNHANWMGATENF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|