C30H27N6O+ — CID 135649025
17-[(E)-(4-tert-butylphenyl)methylideneamino]-14-methyl-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one (PubChem CID 135649025) has the molecular formula C30H27N6O+ and a molecular weight of 487.59 g/mol. Its IUPAC name is 17-[(E)-(4-tert-butylphenyl)methylideneamino]-14-methyl-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one.
| Compound Name | 17-[(E)-(4-tert-butylphenyl)methylideneamino]-14-methyl-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
|---|---|
| PubChem CID | 135649025 |
| Molecular Formula | C30H27N6O+ |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 17-[(E)-(4-tert-butylphenyl)methylideneamino]-14-methyl-13-phenyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
| SMILES | Cc1[nH+]c2c(c(=O)n1-c1ccccc1)c1nc3ccccc3nc1n2/N=C/c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H26N6O/c1-19-32-27-25(29(37)35(19)22-10-6-5-7-11-22)26-28(34-24-13-9-8-12-23(24)33-26)36(27)31-18-20-14-16-21(17-15-20)30(2,3)4/h5-18H,1-4H3/p+1/b31-18+ |
| InChIKey | ULESBJPNVNRPFY-FDAWAROLSA-O |
| XLogP | 5.19 |
| TPSA | 79.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|