C24H23N6O2+ — CID 135517706
13-(2-methoxyethyl)-14-methyl-17-[(3-methylphenyl)methylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one (PubChem CID 135517706) has the molecular formula C24H23N6O2+ and a molecular weight of 427.49 g/mol. Its IUPAC name is 13-(2-methoxyethyl)-14-methyl-17-[(3-methylphenyl)methylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one.
| Compound Name | 13-(2-methoxyethyl)-14-methyl-17-[(3-methylphenyl)methylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
|---|---|
| PubChem CID | 135517706 |
| Molecular Formula | C24H23N6O2+ |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 13-(2-methoxyethyl)-14-methyl-17-[(3-methylphenyl)methylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
| SMILES | COCCn1c(C)[nH+]c2c(c1=O)c1nc3ccccc3nc1n2N=Cc1cccc(C)c1 |
| InChI | InChI=1S/C24H22N6O2/c1-15-7-6-8-17(13-15)14-25-30-22-20(24(31)29(11-12-32-3)16(2)26-22)21-23(30)28-19-10-5-4-9-18(19)27-21/h4-10,13-14H,11-12H2,1-3H3/p+1 |
| InChIKey | SJVOWSKEOYQHGM-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 88.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|