C26H25N6O+ — CID 135450376
14-methyl-17-[(4-propan-2-ylphenyl)methylideneamino]-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one (PubChem CID 135450376) has the molecular formula C26H25N6O+ and a molecular weight of 437.53 g/mol. Its IUPAC name is 14-methyl-17-[(4-propan-2-ylphenyl)methylideneamino]-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one.
| Compound Name | 14-methyl-17-[(4-propan-2-ylphenyl)methylideneamino]-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
|---|---|
| PubChem CID | 135450376 |
| Molecular Formula | C26H25N6O+ |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 14-methyl-17-[(4-propan-2-ylphenyl)methylideneamino]-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
| SMILES | C=CCn1c(C)[nH+]c2c(c1=O)c1nc3ccccc3nc1n2N=Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C26H24N6O/c1-5-14-31-17(4)28-24-22(26(31)33)23-25(30-21-9-7-6-8-20(21)29-23)32(24)27-15-18-10-12-19(13-11-18)16(2)3/h5-13,15-16H,1,14H2,2-4H3/p+1 |
| InChIKey | JPEIILQSQXNQTN-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 79.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|