C29H25N6O+ — CID 135416139
14-methyl-17-[(4-methylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one (PubChem CID 135416139) has the molecular formula C29H25N6O+ and a molecular weight of 473.56 g/mol. Its IUPAC name is 14-methyl-17-[(4-methylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one.
| Compound Name | 14-methyl-17-[(4-methylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
|---|---|
| PubChem CID | 135416139 |
| Molecular Formula | C29H25N6O+ |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 14-methyl-17-[(4-methylphenyl)methylideneamino]-13-(2-phenylethyl)-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
| SMILES | Cc1ccc(C=Nn2c3nc4ccccc4nc3c3c(=O)n(CCc4ccccc4)c(C)[nH+]c32)cc1 |
| InChI | InChI=1S/C29H24N6O/c1-19-12-14-22(15-13-19)18-30-35-27-25(26-28(35)33-24-11-7-6-10-23(24)32-26)29(36)34(20(2)31-27)17-16-21-8-4-3-5-9-21/h3-15,18H,16-17H2,1-2H3/p+1 |
| InChIKey | RRNJKJAZLCXQLE-UHFFFAOYSA-O |
| XLogP | 4.46 |
| TPSA | 79.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|