C25H18N6OS — CID 6891027
13-(2-phenylethyl)-17-[(E)-thiophen-2-ylmethylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 6891027) has the molecular formula C25H18N6OS and a molecular weight of 450.53 g/mol. Its IUPAC name is 13-(2-phenylethyl)-17-[(E)-thiophen-2-ylmethylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 13-(2-phenylethyl)-17-[(E)-thiophen-2-ylmethylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 6891027 |
| Molecular Formula | C25H18N6OS |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 13-(2-phenylethyl)-17-[(E)-thiophen-2-ylmethylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | O=c1c2c3nc4ccccc4nc3n(/N=C/c3cccs3)c2ncn1CCc1ccccc1 |
| InChI | InChI=1S/C25H18N6OS/c32-25-21-22-24(29-20-11-5-4-10-19(20)28-22)31(27-15-18-9-6-14-33-18)23(21)26-16-30(25)13-12-17-7-2-1-3-8-17/h1-11,14-16H,12-13H2/b27-15+ |
| InChIKey | FXPJKWNTFRVYOH-JFLMPSFJSA-N |
| XLogP | 4.48 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|