C31H30N4O3S — CID 3610024
N-[3-(4-methylphenyl)sulfonyl-1-pentylpyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide (PubChem CID 3610024) has the molecular formula C31H30N4O3S and a molecular weight of 538.67 g/mol. Its IUPAC name is N-[3-(4-methylphenyl)sulfonyl-1-pentylpyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-(4-methylphenyl)sulfonyl-1-pentylpyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3610024 |
| Molecular Formula | C31H30N4O3S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | N-[3-(4-methylphenyl)sulfonyl-1-pentylpyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide |
| SMILES | CCCCCn1c(NC(=O)C=Cc2ccccc2)c(S(=O)(=O)c2ccc(C)cc2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C31H30N4O3S/c1-3-4-10-21-35-30-28(32-25-13-8-9-14-26(25)33-30)29(39(37,38)24-18-15-22(2)16-19-24)31(35)34-27(36)20-17-23-11-6-5-7-12-23/h5-9,11-20H,3-4,10,21H2,1-2H3,(H,34,36) |
| InChIKey | URHPREPVBJIPQW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|