C26H24N4O4S2 — CID 3851906
N-[3-(benzenesulfonyl)-1-butylpyrrolo[3,2-b]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 3851906) has the molecular formula C26H24N4O4S2 and a molecular weight of 520.64 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)-1-butylpyrrolo[3,2-b]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-(benzenesulfonyl)-1-butylpyrrolo[3,2-b]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3851906 |
| Molecular Formula | C26H24N4O4S2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | N-[3-(benzenesulfonyl)-1-butylpyrrolo[3,2-b]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | CCCCn1c(NS(=O)(=O)c2ccccc2)c(S(=O)(=O)c2ccccc2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C26H24N4O4S2/c1-2-3-18-30-25-23(27-21-16-10-11-17-22(21)28-25)24(35(31,32)19-12-6-4-7-13-19)26(30)29-36(33,34)20-14-8-5-9-15-20/h4-17,29H,2-3,18H2,1H3 |
| InChIKey | UYOBAEAXZYLXHL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |