C31H32N6O2S — CID 4919311
3-(4-methylphenyl)sulfonyl-1-[1-(1-pentylbenzimidazol-2-yl)ethyl]pyrrolo[3,2-b]quinoxalin-2-amine (PubChem CID 4919311) has the molecular formula C31H32N6O2S and a molecular weight of 552.70 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-1-[1-(1-pentylbenzimidazol-2-yl)ethyl]pyrrolo[3,2-b]quinoxalin-2-amine.
| Compound Name | 3-(4-methylphenyl)sulfonyl-1-[1-(1-pentylbenzimidazol-2-yl)ethyl]pyrrolo[3,2-b]quinoxalin-2-amine |
|---|---|
| PubChem CID | 4919311 |
| Molecular Formula | C31H32N6O2S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-1-[1-(1-pentylbenzimidazol-2-yl)ethyl]pyrrolo[3,2-b]quinoxalin-2-amine |
| SMILES | CCCCCn1c(C(C)n2c(N)c(S(=O)(=O)c3ccc(C)cc3)c3nc4ccccc4nc32)nc2ccccc21 |
| InChI | InChI=1S/C31H32N6O2S/c1-4-5-10-19-36-26-14-9-8-13-25(26)35-30(36)21(3)37-29(32)28(40(38,39)22-17-15-20(2)16-18-22)27-31(37)34-24-12-7-6-11-23(24)33-27/h6-9,11-18,21H,4-5,10,19,32H2,1-3H3 |
| InChIKey | APYXPIDOCJFMOO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|