C22H21N5O7S — CID 2335471
ethyl 1-(2-methoxyethyl)-2-[(4-nitrophenyl)sulfonylamino]pyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 2335471) has the molecular formula C22H21N5O7S and a molecular weight of 499.51 g/mol. Its IUPAC name is ethyl 1-(2-methoxyethyl)-2-[(4-nitrophenyl)sulfonylamino]pyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | ethyl 1-(2-methoxyethyl)-2-[(4-nitrophenyl)sulfonylamino]pyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 2335471 |
| Molecular Formula | C22H21N5O7S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | ethyl 1-(2-methoxyethyl)-2-[(4-nitrophenyl)sulfonylamino]pyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCOC(=O)c1c(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)n(CCOC)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C22H21N5O7S/c1-3-34-22(28)18-19-21(24-17-7-5-4-6-16(17)23-19)26(12-13-33-2)20(18)25-35(31,32)15-10-8-14(9-11-15)27(29)30/h4-11,25H,3,12-13H2,1-2H3 |
| InChIKey | SUUWAJVEWUEWCU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 155.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|