C25H20N4O6 — CID 124548925
(4Z)-4-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 124548925) has the molecular formula C25H20N4O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is (4Z)-4-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 124548925 |
| Molecular Formula | C25H20N4O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (4Z)-4-[[3-methoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | C=CCc1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)cc(OC)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C25H20N4O6/c1-3-7-17-12-16(13-20-24(30)27-28(25(20)31)18-8-5-4-6-9-18)14-21(34-2)23(17)35-22-11-10-19(15-26-22)29(32)33/h3-6,8-15H,1,7H2,2H3,(H,27,30)/b20-13- |
| InChIKey | VPDJEUVCAJIDBB-MOSHPQCFSA-N |
| XLogP | 3.98 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|