C25H16N4O5 — CID 6301106
(4Z)-4-[[2-[(5-nitro-2-pyridinyl)oxy]naphthalen-1-yl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 6301106) has the molecular formula C25H16N4O5 and a molecular weight of 452.43 g/mol. Its IUPAC name is (4Z)-4-[[2-[(5-nitro-2-pyridinyl)oxy]naphthalen-1-yl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[[2-[(5-nitro-2-pyridinyl)oxy]naphthalen-1-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 6301106 |
| Molecular Formula | C25H16N4O5 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (4Z)-4-[[2-[(5-nitro-2-pyridinyl)oxy]naphthalen-1-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C\c1c(Oc2ccc([N+](=O)[O-])cn2)ccc2ccccc12 |
| InChI | InChI=1S/C25H16N4O5/c30-24-21(25(31)28(27-24)17-7-2-1-3-8-17)14-20-19-9-5-4-6-16(19)10-12-22(20)34-23-13-11-18(15-26-23)29(32)33/h1-15H,(H,27,30)/b21-14- |
| InChIKey | YMOPQUGLTXYQPR-STZFKDTASA-N |
| XLogP | 4.40 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|