C27H18Cl2N2O3 — CID 3541278
4-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 3541278) has the molecular formula C27H18Cl2N2O3 and a molecular weight of 489.36 g/mol. Its IUPAC name is 4-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | 4-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 3541278 |
| Molecular Formula | C27H18Cl2N2O3 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 4-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)C1=Cc1c(OCc2ccc(Cl)c(Cl)c2)ccc2ccccc12 |
| InChI | InChI=1S/C27H18Cl2N2O3/c28-23-12-10-17(14-24(23)29)16-34-25-13-11-18-6-4-5-9-20(18)21(25)15-22-26(32)30-31(27(22)33)19-7-2-1-3-8-19/h1-15H,16H2,(H,30,32) |
| InChIKey | CXSVQXZCOHWWHC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|