C21H12I2N4O5 — CID 126406018
(4Z)-4-[[3,5-diiodo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 126406018) has the molecular formula C21H12I2N4O5 and a molecular weight of 654.16 g/mol. Its IUPAC name is (4Z)-4-[[3,5-diiodo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[[3,5-diiodo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 126406018 |
| Molecular Formula | C21H12I2N4O5 |
| Molecular Weight | 654.16 g/mol |
| Exact Mass | 653.89 |
| IUPAC Name | (4Z)-4-[[3,5-diiodo-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C\c1cc(I)c(Oc2ccc([N+](=O)[O-])cn2)c(I)c1 |
| InChI | InChI=1S/C21H12I2N4O5/c22-16-9-12(8-15-20(28)25-26(21(15)29)13-4-2-1-3-5-13)10-17(23)19(16)32-18-7-6-14(11-24-18)27(30)31/h1-11H,(H,25,28)/b15-8- |
| InChIKey | YRNJCGFEMRGKML-NVNXTCNLSA-N |
| XLogP | 4.45 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.16 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|