C16H11IN2O3 — CID 126404338
(4Z)-4-[(4-hydroxy-3-iodophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 126404338) has the molecular formula C16H11IN2O3 and a molecular weight of 406.18 g/mol. Its IUPAC name is (4Z)-4-[(4-hydroxy-3-iodophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[(4-hydroxy-3-iodophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 126404338 |
| Molecular Formula | C16H11IN2O3 |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | (4Z)-4-[(4-hydroxy-3-iodophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C\c1ccc(O)c(I)c1 |
| InChI | InChI=1S/C16H11IN2O3/c17-13-9-10(6-7-14(13)20)8-12-15(21)18-19(16(12)22)11-4-2-1-3-5-11/h1-9,20H,(H,18,21)/b12-8- |
| InChIKey | MMQIONAOHFSVHJ-WQLSENKSSA-N |
| XLogP | 2.46 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|