C21H19IN2O5 — CID 126406061
ethyl (2R)-2-[4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-iodophenoxy]propanoate (PubChem CID 126406061) has the molecular formula C21H19IN2O5 and a molecular weight of 506.30 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-iodophenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-iodophenoxy]propanoate |
|---|---|
| PubChem CID | 126406061 |
| Molecular Formula | C21H19IN2O5 |
| Molecular Weight | 506.30 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | ethyl (2R)-2-[4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-iodophenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc(/C=C2/C(=O)NN(c3ccccc3)C2=O)cc1I |
| InChI | InChI=1S/C21H19IN2O5/c1-3-28-21(27)13(2)29-18-10-9-14(12-17(18)22)11-16-19(25)23-24(20(16)26)15-7-5-4-6-8-15/h4-13H,3H2,1-2H3,(H,23,25)/b16-11-/t13-/m1/s1 |
| InChIKey | YYQYKGVINZLWOM-YYTPVVGHSA-N |
| XLogP | 3.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|