C19H17IN2O3 — CID 124551951
(4Z)-4-[(3-iodo-4-propan-2-yloxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 124551951) has the molecular formula C19H17IN2O3 and a molecular weight of 448.26 g/mol. Its IUPAC name is (4Z)-4-[(3-iodo-4-propan-2-yloxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[(3-iodo-4-propan-2-yloxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 124551951 |
| Molecular Formula | C19H17IN2O3 |
| Molecular Weight | 448.26 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | (4Z)-4-[(3-iodo-4-propan-2-yloxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | CC(C)Oc1ccc(/C=C2/C(=O)NN(c3ccccc3)C2=O)cc1I |
| InChI | InChI=1S/C19H17IN2O3/c1-12(2)25-17-9-8-13(11-16(17)20)10-15-18(23)21-22(19(15)24)14-6-4-3-5-7-14/h3-12H,1-2H3,(H,21,23)/b15-10- |
| InChIKey | QCXJXBUUYWBDLP-GDNBJRDFSA-N |
| XLogP | 3.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|