C17H11N2O4- — CID 7321307
4-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]benzoate (PubChem CID 7321307) has the molecular formula C17H11N2O4- and a molecular weight of 307.29 g/mol. Its IUPAC name is 4-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]benzoate.
| Compound Name | 4-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 7321307 |
| Molecular Formula | C17H11N2O4- |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]benzoate |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C/c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N2O4/c20-15-14(10-11-6-8-12(9-7-11)17(22)23)16(21)19(18-15)13-4-2-1-3-5-13/h1-10H,(H,18,20)(H,22,23)/p-1/b14-10+ |
| InChIKey | PMZCHQSTGZZCIP-GXDHUFHOSA-M |
| XLogP | 0.51 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|