C17H14N2O2S — CID 4022647
4-[(4-methylsulfanylphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 4022647) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-[(4-methylsulfanylphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | 4-[(4-methylsulfanylphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 4022647 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-[(4-methylsulfanylphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | CSc1ccc(C=C2C(=O)NN(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C17H14N2O2S/c1-22-14-9-7-12(8-10-14)11-15-16(20)18-19(17(15)21)13-5-3-2-4-6-13/h2-11H,1H3,(H,18,20) |
| InChIKey | HLFHJMZAOQGFAV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|