C16H10I2N2O3 — CID 6510632
(4E)-4-[(2-hydroxy-3,5-diiodophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 6510632) has the molecular formula C16H10I2N2O3 and a molecular weight of 532.08 g/mol. Its IUPAC name is (4E)-4-[(2-hydroxy-3,5-diiodophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4E)-4-[(2-hydroxy-3,5-diiodophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 6510632 |
| Molecular Formula | C16H10I2N2O3 |
| Molecular Weight | 532.08 g/mol |
| Exact Mass | 531.88 |
| IUPAC Name | (4E)-4-[(2-hydroxy-3,5-diiodophenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)/C1=C/c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C16H10I2N2O3/c17-10-6-9(14(21)13(18)8-10)7-12-15(22)19-20(16(12)23)11-4-2-1-3-5-11/h1-8,21H,(H,19,22)/b12-7+ |
| InChIKey | FEXPGQJRONQLMC-KPKJPENVSA-N |
| XLogP | 3.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.08 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|