C17H12I2N2O3 — CID 2856697
4-[(2-hydroxy-3,5-diiodophenyl)methylidene]-1-(4-methylphenyl)pyrazolidine-3,5-dione (PubChem CID 2856697) has the molecular formula C17H12I2N2O3 and a molecular weight of 546.10 g/mol. Its IUPAC name is 4-[(2-hydroxy-3,5-diiodophenyl)methylidene]-1-(4-methylphenyl)pyrazolidine-3,5-dione.
| Compound Name | 4-[(2-hydroxy-3,5-diiodophenyl)methylidene]-1-(4-methylphenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 2856697 |
| Molecular Formula | C17H12I2N2O3 |
| Molecular Weight | 546.10 g/mol |
| Exact Mass | 545.89 |
| IUPAC Name | 4-[(2-hydroxy-3,5-diiodophenyl)methylidene]-1-(4-methylphenyl)pyrazolidine-3,5-dione |
| SMILES | Cc1ccc(N2NC(=O)C(=Cc3cc(I)cc(I)c3O)C2=O)cc1 |
| InChI | InChI=1S/C17H12I2N2O3/c1-9-2-4-12(5-3-9)21-17(24)13(16(23)20-21)7-10-6-11(18)8-14(19)15(10)22/h2-8,22H,1H3,(H,20,23) |
| InChIKey | APKIJTJGVFIYBB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|