C24H21N5O2S — CID 3927242
2-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 3927242) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 3927242 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[3-[(2,4-dioxo-1H-quinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | Cc1cc(C=Nn2c(=O)[nH]c3ccccc3c2=O)c(C)n1-c1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C24H21N5O2S/c1-14-11-16(13-26-29-22(30)18-8-3-5-9-20(18)27-24(29)31)15(2)28(14)23-19(12-25)17-7-4-6-10-21(17)32-23/h3,5,8-9,11,13H,4,6-7,10H2,1-2H3,(H,27,31) |
| InChIKey | OITRPCNUEZZONS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|