C21H22N4O2 — CID 4313014
3-[(2-methyl-4-piperidin-1-ylphenyl)methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 4313014) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[(2-methyl-4-piperidin-1-ylphenyl)methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(2-methyl-4-piperidin-1-ylphenyl)methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4313014 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[(2-methyl-4-piperidin-1-ylphenyl)methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | Cc1cc(N2CCCCC2)ccc1C=Nn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C21H22N4O2/c1-15-13-17(24-11-5-2-6-12-24)10-9-16(15)14-22-25-20(26)18-7-3-4-8-19(18)23-21(25)27/h3-4,7-10,13-14H,2,5-6,11-12H2,1H3,(H,23,27) |
| InChIKey | IHHLLBLEWLDHRL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|